C21H29N5O5 — CID 53376350
tert-butyl N-[(2S)-3-hydroxy-1-[2-[(1S,3S)-1-methyl-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-3-carbonyl]hydrazinyl]-1-oxopropan-2-yl]carbamate (PubChem CID 53376350) has the molecular formula C21H29N5O5 and a molecular weight of 431.49 g/mol. Its IUPAC name is tert-butyl N-[(2S)-3-hydroxy-1-[2-[(1S,3S)-1-methyl-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-3-carbonyl]hydrazinyl]-1-oxopropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-3-hydroxy-1-[2-[(1S,3S)-1-methyl-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-3-carbonyl]hydrazinyl]-1-oxopropan-2-yl]carbamate |
|---|---|
| PubChem CID | 53376350 |
| Molecular Formula | C21H29N5O5 |
| Molecular Weight | 431.49 g/mol |
| Exact Mass | 431.22 |
| IUPAC Name | tert-butyl N-[(2S)-3-hydroxy-1-[2-[(1S,3S)-1-methyl-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-3-carbonyl]hydrazinyl]-1-oxopropan-2-yl]carbamate |
| SMILES | C[C@@H]1N[C@H](C(=O)NNC(=O)[C@H](CO)NC(=O)OC(C)(C)C)Cc2c1[nH]c1ccccc21 |
| InChI | InChI=1S/C21H29N5O5/c1-11-17-13(12-7-5-6-8-14(12)23-17)9-15(22-11)18(28)25-26-19(29)16(10-27)24-20(30)31-21(2,3)4/h5-8,11,15-16,22-23,27H,9-10H2,1-4H3,(H,24,30)(H,25,28)(H,26,29)/t11-,15-,16-/m0/s1 |
| InChIKey | NFCHMUWQQAHNET-UVBJJODRSA-N |
| XLogP | 0.78 |
| TPSA | 144.58 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.49 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|