C17H20N6O2S — CID 167055305
2-amino-3-methyl-N'-(1-methyl-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-3-carbonyl)thiazete-4-carbohydrazide (PubChem CID 167055305) has the molecular formula C17H20N6O2S and a molecular weight of 372.45 g/mol. Its IUPAC name is 2-amino-3-methyl-N'-(1-methyl-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-3-carbonyl)thiazete-4-carbohydrazide.
| Compound Name | 2-amino-3-methyl-N'-(1-methyl-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-3-carbonyl)thiazete-4-carbohydrazide |
|---|---|
| PubChem CID | 167055305 |
| Molecular Formula | C17H20N6O2S |
| Molecular Weight | 372.45 g/mol |
| Exact Mass | 372.14 |
| IUPAC Name | 2-amino-3-methyl-N'-(1-methyl-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-3-carbonyl)thiazete-4-carbohydrazide |
| SMILES | Cc1c(C(=O)NNC(=O)C2Cc3c([nH]c4ccccc34)C(C)N2)sn1N |
| InChI | InChI=1S/C17H20N6O2S/c1-8-14-11(10-5-3-4-6-12(10)20-14)7-13(19-8)16(24)21-22-17(25)15-9(2)23(18)26-15/h3-6,8,13,19-20H,7,18H2,1-2H3,(H,21,24)(H,22,25) |
| InChIKey | QDDIUNOIZGRNTK-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 116.97 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.45 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|