C20H18Cl2N4O — CID 141400029
(1S,3S)-N-[(2,4-dichlorophenyl)methylideneamino]-1-methyl-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-3-carboxamide (PubChem CID 141400029) has the molecular formula C20H18Cl2N4O and a molecular weight of 401.30 g/mol. Its IUPAC name is (1S,3S)-N-[(2,4-dichlorophenyl)methylideneamino]-1-methyl-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-3-carboxamide.
| Compound Name | (1S,3S)-N-[(2,4-dichlorophenyl)methylideneamino]-1-methyl-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-3-carboxamide |
|---|---|
| PubChem CID | 141400029 |
| Molecular Formula | C20H18Cl2N4O |
| Molecular Weight | 401.30 g/mol |
| Exact Mass | 400.09 |
| IUPAC Name | (1S,3S)-N-[(2,4-dichlorophenyl)methylideneamino]-1-methyl-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-3-carboxamide |
| SMILES | C[C@@H]1N[C@H](C(=O)NN=Cc2ccc(Cl)cc2Cl)Cc2c1[nH]c1ccccc21 |
| InChI | InChI=1S/C20H18Cl2N4O/c1-11-19-15(14-4-2-3-5-17(14)25-19)9-18(24-11)20(27)26-23-10-12-6-7-13(21)8-16(12)22/h2-8,10-11,18,24-25H,9H2,1H3,(H,26,27)/t11-,18-/m0/s1 |
| InChIKey | DATFZUOCSFRSKW-VOJFVSQTSA-N |
| XLogP | 4.20 |
| TPSA | 69.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.30 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|