C19H17Cl2N3O — CID 70121828
N-[(2,4-dichlorophenyl)methylideneamino]-3-propan-2-yl-1H-indole-2-carboxamide (PubChem CID 70121828) has the molecular formula C19H17Cl2N3O and a molecular weight of 374.27 g/mol. Its IUPAC name is N-[(2,4-dichlorophenyl)methylideneamino]-3-propan-2-yl-1H-indole-2-carboxamide.
| Compound Name | N-[(2,4-dichlorophenyl)methylideneamino]-3-propan-2-yl-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 70121828 |
| Molecular Formula | C19H17Cl2N3O |
| Molecular Weight | 374.27 g/mol |
| Exact Mass | 373.07 |
| IUPAC Name | N-[(2,4-dichlorophenyl)methylideneamino]-3-propan-2-yl-1H-indole-2-carboxamide |
| SMILES | CC(C)c1c(C(=O)NN=Cc2ccc(Cl)cc2Cl)[nH]c2ccccc12 |
| InChI | InChI=1S/C19H17Cl2N3O/c1-11(2)17-14-5-3-4-6-16(14)23-18(17)19(25)24-22-10-12-7-8-13(20)9-15(12)21/h3-11,23H,1-2H3,(H,24,25) |
| InChIKey | WVJHPJHTAONHSQ-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 57.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.27 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|