C12H10Cl2N4O2 — CID 40609257
N-[(Z)-(2,4-dichlorophenyl)methylideneamino]-4-methyl-5-oxo-1,2-dihydropyrazole-3-carboxamide (PubChem CID 40609257) has the molecular formula C12H10Cl2N4O2 and a molecular weight of 313.14 g/mol. Its IUPAC name is N-[(Z)-(2,4-dichlorophenyl)methylideneamino]-4-methyl-5-oxo-1,2-dihydropyrazole-3-carboxamide.
| Compound Name | N-[(Z)-(2,4-dichlorophenyl)methylideneamino]-4-methyl-5-oxo-1,2-dihydropyrazole-3-carboxamide |
|---|---|
| PubChem CID | 40609257 |
| Molecular Formula | C12H10Cl2N4O2 |
| Molecular Weight | 313.14 g/mol |
| Exact Mass | 312.02 |
| IUPAC Name | N-[(Z)-(2,4-dichlorophenyl)methylideneamino]-4-methyl-5-oxo-1,2-dihydropyrazole-3-carboxamide |
| SMILES | Cc1c(C(=O)N/N=C\c2ccc(Cl)cc2Cl)[nH][nH]c1=O |
| InChI | InChI=1S/C12H10Cl2N4O2/c1-6-10(16-18-11(6)19)12(20)17-15-5-7-2-3-8(13)4-9(7)14/h2-5H,1H3,(H,17,20)(H2,16,18,19)/b15-5- |
| InChIKey | PAAPEIUCTGWIBZ-WCSRMQSCSA-N |
| XLogP | 2.08 |
| TPSA | 90.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.14 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|