C16H10Cl2N4O2 — CID 9176992
N-[(Z)-(2,4-dichlorophenyl)methylideneamino]-4-oxo-3H-phthalazine-1-carboxamide (PubChem CID 9176992) has the molecular formula C16H10Cl2N4O2 and a molecular weight of 361.19 g/mol. Its IUPAC name is N-[(Z)-(2,4-dichlorophenyl)methylideneamino]-4-oxo-3H-phthalazine-1-carboxamide.
| Compound Name | N-[(Z)-(2,4-dichlorophenyl)methylideneamino]-4-oxo-3H-phthalazine-1-carboxamide |
|---|---|
| PubChem CID | 9176992 |
| Molecular Formula | C16H10Cl2N4O2 |
| Molecular Weight | 361.19 g/mol |
| Exact Mass | 360.02 |
| IUPAC Name | N-[(Z)-(2,4-dichlorophenyl)methylideneamino]-4-oxo-3H-phthalazine-1-carboxamide |
| SMILES | O=C(N/N=C\c1ccc(Cl)cc1Cl)c1n[nH]c(=O)c2ccccc12 |
| InChI | InChI=1S/C16H10Cl2N4O2/c17-10-6-5-9(13(18)7-10)8-19-21-16(24)14-11-3-1-2-4-12(11)15(23)22-20-14/h1-8H,(H,21,24)(H,22,23)/b19-8- |
| InChIKey | HRFGMIAHOVEEJM-UWVJOHFNSA-N |
| XLogP | 2.99 |
| TPSA | 87.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.19 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|