C17H9Cl2F3N4O — CID 2809341
N-[(2,4-dichlorophenyl)methylideneamino]-3-(trifluoromethyl)quinoxaline-2-carboxamide (PubChem CID 2809341) has the molecular formula C17H9Cl2F3N4O and a molecular weight of 413.19 g/mol. Its IUPAC name is N-[(2,4-dichlorophenyl)methylideneamino]-3-(trifluoromethyl)quinoxaline-2-carboxamide.
| Compound Name | N-[(2,4-dichlorophenyl)methylideneamino]-3-(trifluoromethyl)quinoxaline-2-carboxamide |
|---|---|
| PubChem CID | 2809341 |
| Molecular Formula | C17H9Cl2F3N4O |
| Molecular Weight | 413.19 g/mol |
| Exact Mass | 412.01 |
| IUPAC Name | N-[(2,4-dichlorophenyl)methylideneamino]-3-(trifluoromethyl)quinoxaline-2-carboxamide |
| SMILES | O=C(NN=Cc1ccc(Cl)cc1Cl)c1nc2ccccc2nc1C(F)(F)F |
| InChI | InChI=1S/C17H9Cl2F3N4O/c18-10-6-5-9(11(19)7-10)8-23-26-16(27)14-15(17(20,21)22)25-13-4-2-1-3-12(13)24-14/h1-8H,(H,26,27) |
| InChIKey | QBJPYDUOZHEZIC-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 67.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.19 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|