C18H11Cl2F3N4O — CID 175215299
N-[(2,4-dichlorophenyl)methylideneamino]-1-phenyl-5-(trifluoromethyl)pyrazole-4-carboxamide (PubChem CID 175215299) has the molecular formula C18H11Cl2F3N4O and a molecular weight of 427.21 g/mol. Its IUPAC name is N-[(2,4-dichlorophenyl)methylideneamino]-1-phenyl-5-(trifluoromethyl)pyrazole-4-carboxamide.
| Compound Name | N-[(2,4-dichlorophenyl)methylideneamino]-1-phenyl-5-(trifluoromethyl)pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 175215299 |
| Molecular Formula | C18H11Cl2F3N4O |
| Molecular Weight | 427.21 g/mol |
| Exact Mass | 426.03 |
| IUPAC Name | N-[(2,4-dichlorophenyl)methylideneamino]-1-phenyl-5-(trifluoromethyl)pyrazole-4-carboxamide |
| SMILES | O=C(NN=Cc1ccc(Cl)cc1Cl)c1cnn(-c2ccccc2)c1C(F)(F)F |
| InChI | InChI=1S/C18H11Cl2F3N4O/c19-12-7-6-11(15(20)8-12)9-24-26-17(28)14-10-25-27(16(14)18(21,22)23)13-4-2-1-3-5-13/h1-10H,(H,26,28) |
| InChIKey | IKZGWZVFIAVLTO-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 59.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.21 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|