C21H13Cl2F3N4OS — CID 3960977
N-[(4,6-dichloro-2H-thiochromen-3-yl)methylideneamino]-1-phenyl-5-(trifluoromethyl)pyrazole-4-carboxamide (PubChem CID 3960977) has the molecular formula C21H13Cl2F3N4OS and a molecular weight of 497.33 g/mol. Its IUPAC name is N-[(4,6-dichloro-2H-thiochromen-3-yl)methylideneamino]-1-phenyl-5-(trifluoromethyl)pyrazole-4-carboxamide.
| Compound Name | N-[(4,6-dichloro-2H-thiochromen-3-yl)methylideneamino]-1-phenyl-5-(trifluoromethyl)pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 3960977 |
| Molecular Formula | C21H13Cl2F3N4OS |
| Molecular Weight | 497.33 g/mol |
| Exact Mass | 496.01 |
| IUPAC Name | N-[(4,6-dichloro-2H-thiochromen-3-yl)methylideneamino]-1-phenyl-5-(trifluoromethyl)pyrazole-4-carboxamide |
| SMILES | O=C(NN=CC1=C(Cl)c2cc(Cl)ccc2SC1)c1cnn(-c2ccccc2)c1C(F)(F)F |
| InChI | InChI=1S/C21H13Cl2F3N4OS/c22-13-6-7-17-15(8-13)18(23)12(11-32-17)9-27-29-20(31)16-10-28-30(19(16)21(24,25)26)14-4-2-1-3-5-14/h1-10H,11H2,(H,29,31) |
| InChIKey | PTHYFKSXCHVNGY-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 59.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.33 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|