C17H10ClF3N2OS — CID 2807996
S-(4-chlorophenyl) 1-phenyl-5-(trifluoromethyl)pyrazole-4-carbothioate (PubChem CID 2807996) has the molecular formula C17H10ClF3N2OS and a molecular weight of 382.79 g/mol. Its IUPAC name is S-(4-chlorophenyl) 1-phenyl-5-(trifluoromethyl)pyrazole-4-carbothioate.
| Compound Name | S-(4-chlorophenyl) 1-phenyl-5-(trifluoromethyl)pyrazole-4-carbothioate |
|---|---|
| PubChem CID | 2807996 |
| Molecular Formula | C17H10ClF3N2OS |
| Molecular Weight | 382.79 g/mol |
| Exact Mass | 382.02 |
| IUPAC Name | S-(4-chlorophenyl) 1-phenyl-5-(trifluoromethyl)pyrazole-4-carbothioate |
| SMILES | O=C(Sc1ccc(Cl)cc1)c1cnn(-c2ccccc2)c1C(F)(F)F |
| InChI | InChI=1S/C17H10ClF3N2OS/c18-11-6-8-13(9-7-11)25-16(24)14-10-22-23(15(14)17(19,20)21)12-4-2-1-3-5-12/h1-10H |
| InChIKey | OQNHLUXSYGVAAA-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.79 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|