C19H17ClF3N3O — CID 158062941
2-phenylethanamine;1-phenyl-5-(trifluoromethyl)pyrazole-4-carbonyl chloride (PubChem CID 158062941) has the molecular formula C19H17ClF3N3O and a molecular weight of 395.81 g/mol. Its IUPAC name is 2-phenylethanamine;1-phenyl-5-(trifluoromethyl)pyrazole-4-carbonyl chloride.
| Compound Name | 2-phenylethanamine;1-phenyl-5-(trifluoromethyl)pyrazole-4-carbonyl chloride |
|---|---|
| PubChem CID | 158062941 |
| Molecular Formula | C19H17ClF3N3O |
| Molecular Weight | 395.81 g/mol |
| Exact Mass | 395.10 |
| IUPAC Name | 2-phenylethanamine;1-phenyl-5-(trifluoromethyl)pyrazole-4-carbonyl chloride |
| SMILES | NCCc1ccccc1.O=C(Cl)c1cnn(-c2ccccc2)c1C(F)(F)F |
| InChI | InChI=1S/C11H6ClF3N2O.C8H11N/c12-10(18)8-6-16-17(9(8)11(13,14)15)7-4-2-1-3-5-7;9-7-6-8-4-2-1-3-5-8/h1-6H;1-5H,6-7,9H2 |
| InChIKey | FKWHKWOCXCMJCL-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 60.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.81 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|