C17H14ClF3N4O — CID 159637242
1-phenyl-5-(trifluoromethyl)pyrazole-4-carbonyl chloride;pyridin-3-ylmethanamine (PubChem CID 159637242) has the molecular formula C17H14ClF3N4O and a molecular weight of 382.77 g/mol. Its IUPAC name is 1-phenyl-5-(trifluoromethyl)pyrazole-4-carbonyl chloride;pyridin-3-ylmethanamine.
| Compound Name | 1-phenyl-5-(trifluoromethyl)pyrazole-4-carbonyl chloride;pyridin-3-ylmethanamine |
|---|---|
| PubChem CID | 159637242 |
| Molecular Formula | C17H14ClF3N4O |
| Molecular Weight | 382.77 g/mol |
| Exact Mass | 382.08 |
| IUPAC Name | 1-phenyl-5-(trifluoromethyl)pyrazole-4-carbonyl chloride;pyridin-3-ylmethanamine |
| SMILES | NCc1cccnc1.O=C(Cl)c1cnn(-c2ccccc2)c1C(F)(F)F |
| InChI | InChI=1S/C11H6ClF3N2O.C6H8N2/c12-10(18)8-6-16-17(9(8)11(13,14)15)7-4-2-1-3-5-7;7-4-6-2-1-3-8-5-6/h1-6H;1-3,5H,4,7H2 |
| InChIKey | MPXAZGDQOLZJQP-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.77 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|