About 3-phenylpropanoyl chloride;pyridin-3-ylmethanamine
3-phenylpropanoyl chloride;pyridin-3-ylmethanamine (PubChem CID 158248172) has the molecular formula C15H17ClN2O
and a molecular weight of 276.77 g/mol. Its IUPAC name is 3-phenylpropanoyl chloride;pyridin-3-ylmethanamine.
Molecular Properties
| Compound Name | 3-phenylpropanoyl chloride;pyridin-3-ylmethanamine |
| PubChem CID | 158248172 |
| Molecular Formula | C15H17ClN2O |
| Molecular Weight | 276.77 g/mol |
| Exact Mass | 276.10 |
| IUPAC Name | 3-phenylpropanoyl chloride;pyridin-3-ylmethanamine |
| SMILES | NCc1cccnc1.O=C(Cl)CCc1ccccc1 |
| InChI | InChI=1S/C9H9ClO.C6H8N2/c10-9(11)7-6-8-4-2-1-3-5-8;7-4-6-2-1-3-8-5-6/h1-5H,6-7H2;1-3,5H,4,7H2 |
| InChIKey | GGJQLVZKVDVSLV-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 55.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.77 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|
Analyze 3-phenylpropanoyl chloride;pyridin-3-ylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-phenylpropanoyl chloride;pyridin-3-ylmethanamine?
The IUPAC name of 3-phenylpropanoyl chloride;pyridin-3-ylmethanamine (CID 158248172) is 3-phenylpropanoyl chloride;pyridin-3-ylmethanamine.
What is the SMILES notation for 3-phenylpropanoyl chloride;pyridin-3-ylmethanamine?
The canonical SMILES for 3-phenylpropanoyl chloride;pyridin-3-ylmethanamine is NCc1cccnc1.O=C(Cl)CCc1ccccc1.
What is the InChIKey of 3-phenylpropanoyl chloride;pyridin-3-ylmethanamine?
The InChIKey is GGJQLVZKVDVSLV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9ClO.C6H8N2/c10-9(11)7-6-8-4-2-1-3-5-8;7-4-6-2-1-3-8-5-6/h1-5H,6-7H2;1-3,5H,4,7H2.
What are the key properties of 3-phenylpropanoyl chloride;pyridin-3-ylmethanamine?
3-phenylpropanoyl chloride;pyridin-3-ylmethanamine has a molecular weight of 276.77 g/mol, XLogP of 2.92, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-phenylpropanoyl chloride;pyridin-3-ylmethanamine is sourced from PubChem (CID 158248172), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).