About 4-phenylbutanoyl chloride
4-phenylbutanoyl chloride (PubChem CID 11789865) has the molecular formula C10H11ClO
and a molecular weight of 182.65 g/mol. Its IUPAC name is 4-phenylbutanoyl chloride.
Molecular Properties
| Compound Name | 4-phenylbutanoyl chloride |
| PubChem CID | 11789865 |
| Molecular Formula | C10H11ClO |
| Molecular Weight | 182.65 g/mol |
| Exact Mass | 182.05 |
| IUPAC Name | 4-phenylbutanoyl chloride |
| SMILES | O=C(Cl)CCCc1ccccc1 |
| InChI | InChI=1S/C10H11ClO/c11-10(12)8-4-7-9-5-2-1-3-6-9/h1-3,5-6H,4,7-8H2 |
| InChIKey | VQDQISMDUHBUFF-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.65 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|
Analyze 4-phenylbutanoyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-phenylbutanoyl chloride?
The IUPAC name of 4-phenylbutanoyl chloride (CID 11789865) is 4-phenylbutanoyl chloride.
What is the SMILES notation for 4-phenylbutanoyl chloride?
The canonical SMILES for 4-phenylbutanoyl chloride is O=C(Cl)CCCc1ccccc1.
What is the InChIKey of 4-phenylbutanoyl chloride?
The InChIKey is VQDQISMDUHBUFF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11ClO/c11-10(12)8-4-7-9-5-2-1-3-6-9/h1-3,5-6H,4,7-8H2.
What are the key properties of 4-phenylbutanoyl chloride?
4-phenylbutanoyl chloride has a molecular weight of 182.65 g/mol, XLogP of 2.77, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-phenylbutanoyl chloride is sourced from PubChem (CID 11789865), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).