4-[4-(trifluoromethyl)phenyl]butanoyl chloride

C11H10ClF3O — CID 165349049

IUPAC4-[4-(trifluoromethyl)phenyl]butanoyl chloride
SMILESO=C(Cl)CCCc1ccc(C(F)(F)F)cc1
InChIInChI=1S/C11H10ClF3O/c12-10(16)3-1-2-8-4-6-9(7-5-8)11(13,14)15/h4-7H,1-3H2
InChIKeyLTWBZDGMMNSVGT-UHFFFAOYSA-N
MW250.65 g/mol
LogP3.79
Rot. Bonds4

About 4-[4-(trifluoromethyl)phenyl]butanoyl chloride

4-[4-(trifluoromethyl)phenyl]butanoyl chloride (PubChem CID 165349049) has the molecular formula C11H10ClF3O and a molecular weight of 250.65 g/mol. Its IUPAC name is 4-[4-(trifluoromethyl)phenyl]butanoyl chloride.

Molecular Properties

Compound Name4-[4-(trifluoromethyl)phenyl]butanoyl chloride
PubChem CID165349049
Molecular FormulaC11H10ClF3O
Molecular Weight250.65 g/mol
Exact Mass250.04
IUPAC Name4-[4-(trifluoromethyl)phenyl]butanoyl chloride
SMILESO=C(Cl)CCCc1ccc(C(F)(F)F)cc1
InChIInChI=1S/C11H10ClF3O/c12-10(16)3-1-2-8-4-6-9(7-5-8)11(13,14)15/h4-7H,1-3H2
InChIKeyLTWBZDGMMNSVGT-UHFFFAOYSA-N
XLogP3.79
TPSA17.07 Ų
H-Bond Donors
H-Bond Acceptors1
Rotatable Bonds4
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500250.65
LogP ≤ 53.79
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acid_halide', 'substructure': 'N/A'}

Analyze 4-[4-(trifluoromethyl)phenyl]butanoyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-[4-(trifluoromethyl)phenyl]butanoyl chloride?
The IUPAC name of 4-[4-(trifluoromethyl)phenyl]butanoyl chloride (CID 165349049) is 4-[4-(trifluoromethyl)phenyl]butanoyl chloride.
What is the SMILES notation for 4-[4-(trifluoromethyl)phenyl]butanoyl chloride?
The canonical SMILES for 4-[4-(trifluoromethyl)phenyl]butanoyl chloride is O=C(Cl)CCCc1ccc(C(F)(F)F)cc1.
What is the InChIKey of 4-[4-(trifluoromethyl)phenyl]butanoyl chloride?
The InChIKey is LTWBZDGMMNSVGT-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10ClF3O/c12-10(16)3-1-2-8-4-6-9(7-5-8)11(13,14)15/h4-7H,1-3H2.
What are the key properties of 4-[4-(trifluoromethyl)phenyl]butanoyl chloride?
4-[4-(trifluoromethyl)phenyl]butanoyl chloride has a molecular weight of 250.65 g/mol, XLogP of 3.79, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[4-(trifluoromethyl)phenyl]butanoyl chloride is sourced from PubChem (CID 165349049), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).