C17H13FN4O4S — CID 166222246
N-[(E)-(2-fluoro-4-methylsulfonylphenyl)methylideneamino]-4-oxo-3H-phthalazine-1-carboxamide (PubChem CID 166222246) has the molecular formula C17H13FN4O4S and a molecular weight of 388.38 g/mol. Its IUPAC name is N-[(E)-(2-fluoro-4-methylsulfonylphenyl)methylideneamino]-4-oxo-3H-phthalazine-1-carboxamide.
| Compound Name | N-[(E)-(2-fluoro-4-methylsulfonylphenyl)methylideneamino]-4-oxo-3H-phthalazine-1-carboxamide |
|---|---|
| PubChem CID | 166222246 |
| Molecular Formula | C17H13FN4O4S |
| Molecular Weight | 388.38 g/mol |
| Exact Mass | 388.06 |
| IUPAC Name | N-[(E)-(2-fluoro-4-methylsulfonylphenyl)methylideneamino]-4-oxo-3H-phthalazine-1-carboxamide |
| SMILES | CS(=O)(=O)c1ccc(/C=N/NC(=O)c2n[nH]c(=O)c3ccccc23)c(F)c1 |
| InChI | InChI=1S/C17H13FN4O4S/c1-27(25,26)11-7-6-10(14(18)8-11)9-19-21-17(24)15-12-4-2-3-5-13(12)16(23)22-20-15/h2-9H,1H3,(H,21,24)(H,22,23)/b19-9+ |
| InChIKey | QGHXXOUVEGZJCH-DJKKODMXSA-N |
| XLogP | 1.23 |
| TPSA | 121.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.38 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|