C22H17N5O2 — CID 7530707
N-[(Z)-(4-anilinophenyl)methylideneamino]-4-oxo-3H-phthalazine-1-carboxamide (PubChem CID 7530707) has the molecular formula C22H17N5O2 and a molecular weight of 383.41 g/mol. Its IUPAC name is N-[(Z)-(4-anilinophenyl)methylideneamino]-4-oxo-3H-phthalazine-1-carboxamide.
| Compound Name | N-[(Z)-(4-anilinophenyl)methylideneamino]-4-oxo-3H-phthalazine-1-carboxamide |
|---|---|
| PubChem CID | 7530707 |
| Molecular Formula | C22H17N5O2 |
| Molecular Weight | 383.41 g/mol |
| Exact Mass | 383.14 |
| IUPAC Name | N-[(Z)-(4-anilinophenyl)methylideneamino]-4-oxo-3H-phthalazine-1-carboxamide |
| SMILES | O=C(N/N=C\c1ccc(Nc2ccccc2)cc1)c1n[nH]c(=O)c2ccccc12 |
| InChI | InChI=1S/C22H17N5O2/c28-21-19-9-5-4-8-18(19)20(25-27-21)22(29)26-23-14-15-10-12-17(13-11-15)24-16-6-2-1-3-7-16/h1-14,24H,(H,26,29)(H,27,28)/b23-14- |
| InChIKey | GRJHHOLHDSBZNY-UCQKPKSFSA-N |
| XLogP | 3.43 |
| TPSA | 99.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.41 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|