C17H14N6O4 — CID 55352669
N-[(E)-[4-(methylamino)-3-nitrophenyl]methylideneamino]-4-oxo-3H-phthalazine-1-carboxamide (PubChem CID 55352669) has the molecular formula C17H14N6O4 and a molecular weight of 366.34 g/mol. Its IUPAC name is N-[(E)-[4-(methylamino)-3-nitrophenyl]methylideneamino]-4-oxo-3H-phthalazine-1-carboxamide.
| Compound Name | N-[(E)-[4-(methylamino)-3-nitrophenyl]methylideneamino]-4-oxo-3H-phthalazine-1-carboxamide |
|---|---|
| PubChem CID | 55352669 |
| Molecular Formula | C17H14N6O4 |
| Molecular Weight | 366.34 g/mol |
| Exact Mass | 366.11 |
| IUPAC Name | N-[(E)-[4-(methylamino)-3-nitrophenyl]methylideneamino]-4-oxo-3H-phthalazine-1-carboxamide |
| SMILES | CNc1ccc(/C=N/NC(=O)c2n[nH]c(=O)c3ccccc23)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H14N6O4/c1-18-13-7-6-10(8-14(13)23(26)27)9-19-21-17(25)15-11-4-2-3-5-12(11)16(24)22-20-15/h2-9,18H,1H3,(H,21,25)(H,22,24)/b19-9+ |
| InChIKey | NLRHLNONRYKQCG-DJKKODMXSA-N |
| XLogP | 1.64 |
| TPSA | 142.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.34 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|