C17H14N4O4 — CID 2511469
N-(2,4-dimethyl-5-nitrophenyl)-4-oxo-3H-phthalazine-1-carboxamide (PubChem CID 2511469) has the molecular formula C17H14N4O4 and a molecular weight of 338.32 g/mol. Its IUPAC name is N-(2,4-dimethyl-5-nitrophenyl)-4-oxo-3H-phthalazine-1-carboxamide.
| Compound Name | N-(2,4-dimethyl-5-nitrophenyl)-4-oxo-3H-phthalazine-1-carboxamide |
|---|---|
| PubChem CID | 2511469 |
| Molecular Formula | C17H14N4O4 |
| Molecular Weight | 338.32 g/mol |
| Exact Mass | 338.10 |
| IUPAC Name | N-(2,4-dimethyl-5-nitrophenyl)-4-oxo-3H-phthalazine-1-carboxamide |
| SMILES | Cc1cc(C)c([N+](=O)[O-])cc1NC(=O)c1n[nH]c(=O)c2ccccc12 |
| InChI | InChI=1S/C17H14N4O4/c1-9-7-10(2)14(21(24)25)8-13(9)18-17(23)15-11-5-3-4-6-12(11)16(22)20-19-15/h3-8H,1-2H3,(H,18,23)(H,20,22) |
| InChIKey | YVYDLNWUIQZECO-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 117.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.32 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|