C24H16Cl2N4O2 — CID 6871078
N-[(E)-(2,4-dichlorophenyl)methylideneamino]-6-oxo-3,4-diphenyl-1H-pyridazine-5-carboxamide (PubChem CID 6871078) has the molecular formula C24H16Cl2N4O2 and a molecular weight of 463.32 g/mol. Its IUPAC name is N-[(E)-(2,4-dichlorophenyl)methylideneamino]-6-oxo-3,4-diphenyl-1H-pyridazine-5-carboxamide.
| Compound Name | N-[(E)-(2,4-dichlorophenyl)methylideneamino]-6-oxo-3,4-diphenyl-1H-pyridazine-5-carboxamide |
|---|---|
| PubChem CID | 6871078 |
| Molecular Formula | C24H16Cl2N4O2 |
| Molecular Weight | 463.32 g/mol |
| Exact Mass | 462.07 |
| IUPAC Name | N-[(E)-(2,4-dichlorophenyl)methylideneamino]-6-oxo-3,4-diphenyl-1H-pyridazine-5-carboxamide |
| SMILES | O=C(N/N=C/c1ccc(Cl)cc1Cl)c1c(-c2ccccc2)c(-c2ccccc2)n[nH]c1=O |
| InChI | InChI=1S/C24H16Cl2N4O2/c25-18-12-11-17(19(26)13-18)14-27-29-23(31)21-20(15-7-3-1-4-8-15)22(28-30-24(21)32)16-9-5-2-6-10-16/h1-14H,(H,29,31)(H,30,32)/b27-14+ |
| InChIKey | NSZZQSZNMMLYNF-MZJWZYIUSA-N |
| XLogP | 5.17 |
| TPSA | 87.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.32 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|