C27H24N4O2 — CID 6871082
6-oxo-3,4-diphenyl-N-[(E)-(4-propan-2-ylphenyl)methylideneamino]-1H-pyridazine-5-carboxamide (PubChem CID 6871082) has the molecular formula C27H24N4O2 and a molecular weight of 436.52 g/mol. Its IUPAC name is 6-oxo-3,4-diphenyl-N-[(E)-(4-propan-2-ylphenyl)methylideneamino]-1H-pyridazine-5-carboxamide.
| Compound Name | 6-oxo-3,4-diphenyl-N-[(E)-(4-propan-2-ylphenyl)methylideneamino]-1H-pyridazine-5-carboxamide |
|---|---|
| PubChem CID | 6871082 |
| Molecular Formula | C27H24N4O2 |
| Molecular Weight | 436.52 g/mol |
| Exact Mass | 436.19 |
| IUPAC Name | 6-oxo-3,4-diphenyl-N-[(E)-(4-propan-2-ylphenyl)methylideneamino]-1H-pyridazine-5-carboxamide |
| SMILES | CC(C)c1ccc(/C=N/NC(=O)c2c(-c3ccccc3)c(-c3ccccc3)n[nH]c2=O)cc1 |
| InChI | InChI=1S/C27H24N4O2/c1-18(2)20-15-13-19(14-16-20)17-28-30-26(32)24-23(21-9-5-3-6-10-21)25(29-31-27(24)33)22-11-7-4-8-12-22/h3-18H,1-2H3,(H,30,32)(H,31,33)/b28-17+ |
| InChIKey | UQNVFCIKIXQSNY-OGLMXYFKSA-N |
| XLogP | 4.99 |
| TPSA | 87.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.52 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|