C24H17ClN4O2 — CID 6871077
N-[(E)-(4-chlorophenyl)methylideneamino]-6-oxo-3,4-diphenyl-1H-pyridazine-5-carboxamide (PubChem CID 6871077) has the molecular formula C24H17ClN4O2 and a molecular weight of 428.88 g/mol. Its IUPAC name is N-[(E)-(4-chlorophenyl)methylideneamino]-6-oxo-3,4-diphenyl-1H-pyridazine-5-carboxamide.
| Compound Name | N-[(E)-(4-chlorophenyl)methylideneamino]-6-oxo-3,4-diphenyl-1H-pyridazine-5-carboxamide |
|---|---|
| PubChem CID | 6871077 |
| Molecular Formula | C24H17ClN4O2 |
| Molecular Weight | 428.88 g/mol |
| Exact Mass | 428.10 |
| IUPAC Name | N-[(E)-(4-chlorophenyl)methylideneamino]-6-oxo-3,4-diphenyl-1H-pyridazine-5-carboxamide |
| SMILES | O=C(N/N=C/c1ccc(Cl)cc1)c1c(-c2ccccc2)c(-c2ccccc2)n[nH]c1=O |
| InChI | InChI=1S/C24H17ClN4O2/c25-19-13-11-16(12-14-19)15-26-28-23(30)21-20(17-7-3-1-4-8-17)22(27-29-24(21)31)18-9-5-2-6-10-18/h1-15H,(H,28,30)(H,29,31)/b26-15+ |
| InChIKey | CKWCQCDYSBRGIT-CVKSISIWSA-N |
| XLogP | 4.52 |
| TPSA | 87.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.88 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|