C24H17Cl2N5O3 — CID 2831899
N-[2-[2-[(2,4-dichlorophenyl)methylidene]hydrazinyl]-2-oxo-1-(4-oxo-3H-phthalazin-1-yl)ethyl]benzamide (PubChem CID 2831899) has the molecular formula C24H17Cl2N5O3 and a molecular weight of 494.34 g/mol. Its IUPAC name is N-[2-[2-[(2,4-dichlorophenyl)methylidene]hydrazinyl]-2-oxo-1-(4-oxo-3H-phthalazin-1-yl)ethyl]benzamide.
| Compound Name | N-[2-[2-[(2,4-dichlorophenyl)methylidene]hydrazinyl]-2-oxo-1-(4-oxo-3H-phthalazin-1-yl)ethyl]benzamide |
|---|---|
| PubChem CID | 2831899 |
| Molecular Formula | C24H17Cl2N5O3 |
| Molecular Weight | 494.34 g/mol |
| Exact Mass | 493.07 |
| IUPAC Name | N-[2-[2-[(2,4-dichlorophenyl)methylidene]hydrazinyl]-2-oxo-1-(4-oxo-3H-phthalazin-1-yl)ethyl]benzamide |
| SMILES | O=C(NC(C(=O)NN=Cc1ccc(Cl)cc1Cl)c1n[nH]c(=O)c2ccccc12)c1ccccc1 |
| InChI | InChI=1S/C24H17Cl2N5O3/c25-16-11-10-15(19(26)12-16)13-27-30-24(34)21(28-22(32)14-6-2-1-3-7-14)20-17-8-4-5-9-18(17)23(33)31-29-20/h1-13,21H,(H,28,32)(H,30,34)(H,31,33) |
| InChIKey | HXTQGFHDPALTHP-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 116.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.34 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|