C24H17ClN6O5 — CID 4223197
N-[2-[2-[(4-chloro-3-nitrophenyl)methylidene]hydrazinyl]-2-oxo-1-(4-oxo-3H-phthalazin-1-yl)ethyl]benzamide (PubChem CID 4223197) has the molecular formula C24H17ClN6O5 and a molecular weight of 504.89 g/mol. Its IUPAC name is N-[2-[2-[(4-chloro-3-nitrophenyl)methylidene]hydrazinyl]-2-oxo-1-(4-oxo-3H-phthalazin-1-yl)ethyl]benzamide.
| Compound Name | N-[2-[2-[(4-chloro-3-nitrophenyl)methylidene]hydrazinyl]-2-oxo-1-(4-oxo-3H-phthalazin-1-yl)ethyl]benzamide |
|---|---|
| PubChem CID | 4223197 |
| Molecular Formula | C24H17ClN6O5 |
| Molecular Weight | 504.89 g/mol |
| Exact Mass | 504.09 |
| IUPAC Name | N-[2-[2-[(4-chloro-3-nitrophenyl)methylidene]hydrazinyl]-2-oxo-1-(4-oxo-3H-phthalazin-1-yl)ethyl]benzamide |
| SMILES | O=C(NC(C(=O)NN=Cc1ccc(Cl)c([N+](=O)[O-])c1)c1n[nH]c(=O)c2ccccc12)c1ccccc1 |
| InChI | InChI=1S/C24H17ClN6O5/c25-18-11-10-14(12-19(18)31(35)36)13-26-29-24(34)21(27-22(32)15-6-2-1-3-7-15)20-16-8-4-5-9-17(16)23(33)30-28-20/h1-13,21H,(H,27,32)(H,29,34)(H,30,33) |
| InChIKey | NETHTNLPNXXNTD-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 159.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.89 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|