C32H26N6O7 — CID 3510583
N-[2-[2-[[3-methoxy-4-[(4-nitrophenoxy)methyl]phenyl]methylidene]hydrazinyl]-2-oxo-1-(4-oxo-3H-phthalazin-1-yl)ethyl]benzamide (PubChem CID 3510583) has the molecular formula C32H26N6O7 and a molecular weight of 606.60 g/mol. Its IUPAC name is N-[2-[2-[[3-methoxy-4-[(4-nitrophenoxy)methyl]phenyl]methylidene]hydrazinyl]-2-oxo-1-(4-oxo-3H-phthalazin-1-yl)ethyl]benzamide.
| Compound Name | N-[2-[2-[[3-methoxy-4-[(4-nitrophenoxy)methyl]phenyl]methylidene]hydrazinyl]-2-oxo-1-(4-oxo-3H-phthalazin-1-yl)ethyl]benzamide |
|---|---|
| PubChem CID | 3510583 |
| Molecular Formula | C32H26N6O7 |
| Molecular Weight | 606.60 g/mol |
| Exact Mass | 606.19 |
| IUPAC Name | N-[2-[2-[[3-methoxy-4-[(4-nitrophenoxy)methyl]phenyl]methylidene]hydrazinyl]-2-oxo-1-(4-oxo-3H-phthalazin-1-yl)ethyl]benzamide |
| SMILES | COc1cc(C=NNC(=O)C(NC(=O)c2ccccc2)c2n[nH]c(=O)c3ccccc23)ccc1COc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C32H26N6O7/c1-44-27-17-20(11-12-22(27)19-45-24-15-13-23(14-16-24)38(42)43)18-33-36-32(41)29(34-30(39)21-7-3-2-4-8-21)28-25-9-5-6-10-26(25)31(40)37-35-28/h2-18,29H,19H2,1H3,(H,34,39)(H,36,41)(H,37,40) |
| InChIKey | SVGPQLPEZDHNTE-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 177.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.60 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|