C31H24BrN5O4 — CID 129441233
N-[(1S)-2-[2-[[2-[(4-bromophenyl)methoxy]phenyl]methylidene]hydrazinyl]-2-oxo-1-(4-oxo-3H-phthalazin-1-yl)ethyl]benzamide (PubChem CID 129441233) has the molecular formula C31H24BrN5O4 and a molecular weight of 610.47 g/mol. Its IUPAC name is N-[(1S)-2-[2-[[2-[(4-bromophenyl)methoxy]phenyl]methylidene]hydrazinyl]-2-oxo-1-(4-oxo-3H-phthalazin-1-yl)ethyl]benzamide.
| Compound Name | N-[(1S)-2-[2-[[2-[(4-bromophenyl)methoxy]phenyl]methylidene]hydrazinyl]-2-oxo-1-(4-oxo-3H-phthalazin-1-yl)ethyl]benzamide |
|---|---|
| PubChem CID | 129441233 |
| Molecular Formula | C31H24BrN5O4 |
| Molecular Weight | 610.47 g/mol |
| Exact Mass | 609.10 |
| IUPAC Name | N-[(1S)-2-[2-[[2-[(4-bromophenyl)methoxy]phenyl]methylidene]hydrazinyl]-2-oxo-1-(4-oxo-3H-phthalazin-1-yl)ethyl]benzamide |
| SMILES | O=C(N[C@H](C(=O)NN=Cc1ccccc1OCc1ccc(Br)cc1)c1n[nH]c(=O)c2ccccc12)c1ccccc1 |
| InChI | InChI=1S/C31H24BrN5O4/c32-23-16-14-20(15-17-23)19-41-26-13-7-4-10-22(26)18-33-36-31(40)28(34-29(38)21-8-2-1-3-9-21)27-24-11-5-6-12-25(24)30(39)37-35-27/h1-18,28H,19H2,(H,34,38)(H,36,40)(H,37,39)/t28-/m0/s1 |
| InChIKey | YJTVSEWOANEOHR-NDEPHWFRSA-N |
| XLogP | 4.89 |
| TPSA | 125.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.47 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|