C25H18N6O3 — CID 3265304
N-[2-[2-[(4-cyanophenyl)methylidene]hydrazinyl]-2-oxo-1-(4-oxo-3H-phthalazin-1-yl)ethyl]benzamide (PubChem CID 3265304) has the molecular formula C25H18N6O3 and a molecular weight of 450.46 g/mol. Its IUPAC name is N-[2-[2-[(4-cyanophenyl)methylidene]hydrazinyl]-2-oxo-1-(4-oxo-3H-phthalazin-1-yl)ethyl]benzamide.
| Compound Name | N-[2-[2-[(4-cyanophenyl)methylidene]hydrazinyl]-2-oxo-1-(4-oxo-3H-phthalazin-1-yl)ethyl]benzamide |
|---|---|
| PubChem CID | 3265304 |
| Molecular Formula | C25H18N6O3 |
| Molecular Weight | 450.46 g/mol |
| Exact Mass | 450.14 |
| IUPAC Name | N-[2-[2-[(4-cyanophenyl)methylidene]hydrazinyl]-2-oxo-1-(4-oxo-3H-phthalazin-1-yl)ethyl]benzamide |
| SMILES | N#Cc1ccc(C=NNC(=O)C(NC(=O)c2ccccc2)c2n[nH]c(=O)c3ccccc23)cc1 |
| InChI | InChI=1S/C25H18N6O3/c26-14-16-10-12-17(13-11-16)15-27-30-25(34)22(28-23(32)18-6-2-1-3-7-18)21-19-8-4-5-9-20(19)24(33)31-29-21/h1-13,15,22H,(H,28,32)(H,30,34)(H,31,33) |
| InChIKey | LJPYFAQRMLDPOJ-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 140.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.46 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|