C22H16N6O6 — CID 92847195
N-[(1S)-2-[(2Z)-2-[(5-nitrofuran-2-yl)methylidene]hydrazinyl]-2-oxo-1-(4-oxo-3H-phthalazin-1-yl)ethyl]benzamide (PubChem CID 92847195) has the molecular formula C22H16N6O6 and a molecular weight of 460.41 g/mol. Its IUPAC name is N-[(1S)-2-[(2Z)-2-[(5-nitrofuran-2-yl)methylidene]hydrazinyl]-2-oxo-1-(4-oxo-3H-phthalazin-1-yl)ethyl]benzamide.
| Compound Name | N-[(1S)-2-[(2Z)-2-[(5-nitrofuran-2-yl)methylidene]hydrazinyl]-2-oxo-1-(4-oxo-3H-phthalazin-1-yl)ethyl]benzamide |
|---|---|
| PubChem CID | 92847195 |
| Molecular Formula | C22H16N6O6 |
| Molecular Weight | 460.41 g/mol |
| Exact Mass | 460.11 |
| IUPAC Name | N-[(1S)-2-[(2Z)-2-[(5-nitrofuran-2-yl)methylidene]hydrazinyl]-2-oxo-1-(4-oxo-3H-phthalazin-1-yl)ethyl]benzamide |
| SMILES | O=C(N[C@H](C(=O)N/N=C\c1ccc([N+](=O)[O-])o1)c1n[nH]c(=O)c2ccccc12)c1ccccc1 |
| InChI | InChI=1S/C22H16N6O6/c29-20(13-6-2-1-3-7-13)24-19(18-15-8-4-5-9-16(15)21(30)27-25-18)22(31)26-23-12-14-10-11-17(34-14)28(32)33/h1-12,19H,(H,24,29)(H,26,31)(H,27,30)/b23-12-/t19-/m0/s1 |
| InChIKey | BDLLKVOJEYSWML-OLRBPVQESA-N |
| XLogP | 2.05 |
| TPSA | 172.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.41 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|