C20H17Cl2N3O — CID 110336948
N-[(E)-(2,4-dichlorophenyl)methylideneamino]-6,7,8,9-tetrahydro-5H-carbazole-3-carboxamide (PubChem CID 110336948) has the molecular formula C20H17Cl2N3O and a molecular weight of 386.28 g/mol. Its IUPAC name is N-[(E)-(2,4-dichlorophenyl)methylideneamino]-6,7,8,9-tetrahydro-5H-carbazole-3-carboxamide.
| Compound Name | N-[(E)-(2,4-dichlorophenyl)methylideneamino]-6,7,8,9-tetrahydro-5H-carbazole-3-carboxamide |
|---|---|
| PubChem CID | 110336948 |
| Molecular Formula | C20H17Cl2N3O |
| Molecular Weight | 386.28 g/mol |
| Exact Mass | 385.07 |
| IUPAC Name | N-[(E)-(2,4-dichlorophenyl)methylideneamino]-6,7,8,9-tetrahydro-5H-carbazole-3-carboxamide |
| SMILES | O=C(N/N=C/c1ccc(Cl)cc1Cl)c1ccc2[nH]c3c(c2c1)CCCC3 |
| InChI | InChI=1S/C20H17Cl2N3O/c21-14-7-5-13(17(22)10-14)11-23-25-20(26)12-6-8-19-16(9-12)15-3-1-2-4-18(15)24-19/h5-11,24H,1-4H2,(H,25,26)/b23-11+ |
| InChIKey | PXTMBJDDIWNGHA-FOKLQQMPSA-N |
| XLogP | 5.12 |
| TPSA | 57.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.28 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|