C23H25N3O2 — CID 110340901
N-[(E)-(2-propan-2-yloxyphenyl)methylideneamino]-6,7,8,9-tetrahydro-5H-carbazole-3-carboxamide (PubChem CID 110340901) has the molecular formula C23H25N3O2 and a molecular weight of 375.47 g/mol. Its IUPAC name is N-[(E)-(2-propan-2-yloxyphenyl)methylideneamino]-6,7,8,9-tetrahydro-5H-carbazole-3-carboxamide.
| Compound Name | N-[(E)-(2-propan-2-yloxyphenyl)methylideneamino]-6,7,8,9-tetrahydro-5H-carbazole-3-carboxamide |
|---|---|
| PubChem CID | 110340901 |
| Molecular Formula | C23H25N3O2 |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.19 |
| IUPAC Name | N-[(E)-(2-propan-2-yloxyphenyl)methylideneamino]-6,7,8,9-tetrahydro-5H-carbazole-3-carboxamide |
| SMILES | CC(C)Oc1ccccc1/C=N/NC(=O)c1ccc2[nH]c3c(c2c1)CCCC3 |
| InChI | InChI=1S/C23H25N3O2/c1-15(2)28-22-10-6-3-7-17(22)14-24-26-23(27)16-11-12-21-19(13-16)18-8-4-5-9-20(18)25-21/h3,6-7,10-15,25H,4-5,8-9H2,1-2H3,(H,26,27)/b24-14+ |
| InChIKey | PLUURIYHNLDLEM-ZVHZXABRSA-N |
| XLogP | 4.60 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|