C24H22N4O2 — CID 167067067
(1S,3S)-N-[(E)-(6-hydroxynaphthalen-2-yl)methylideneamino]-1-methyl-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-3-carboxamide (PubChem CID 167067067) has the molecular formula C24H22N4O2 and a molecular weight of 398.47 g/mol. Its IUPAC name is (1S,3S)-N-[(E)-(6-hydroxynaphthalen-2-yl)methylideneamino]-1-methyl-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-3-carboxamide.
| Compound Name | (1S,3S)-N-[(E)-(6-hydroxynaphthalen-2-yl)methylideneamino]-1-methyl-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-3-carboxamide |
|---|---|
| PubChem CID | 167067067 |
| Molecular Formula | C24H22N4O2 |
| Molecular Weight | 398.47 g/mol |
| Exact Mass | 398.17 |
| IUPAC Name | (1S,3S)-N-[(E)-(6-hydroxynaphthalen-2-yl)methylideneamino]-1-methyl-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-3-carboxamide |
| SMILES | C[C@@H]1N[C@H](C(=O)N/N=C/c2ccc3cc(O)ccc3c2)Cc2c1[nH]c1ccccc21 |
| InChI | InChI=1S/C24H22N4O2/c1-14-23-20(19-4-2-3-5-21(19)27-23)12-22(26-14)24(30)28-25-13-15-6-7-17-11-18(29)9-8-16(17)10-15/h2-11,13-14,22,26-27,29H,12H2,1H3,(H,28,30)/b25-13+/t14-,22-/m0/s1 |
| InChIKey | MFHAIDAGLJRGIJ-GXKPVHOQSA-N |
| XLogP | 3.75 |
| TPSA | 89.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.47 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|