C22H31N5O4 — CID 101084738
(2S)-2-[[(2S)-2-[[1-(aminomethyl)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-3-carbonyl]amino]-4-methylpentanoyl]amino]propanoic acid (PubChem CID 101084738) has the molecular formula C22H31N5O4 and a molecular weight of 429.52 g/mol. Its IUPAC name is (2S)-2-[[(2S)-2-[[1-(aminomethyl)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-3-carbonyl]amino]-4-methylpentanoyl]amino]propanoic acid.
| Compound Name | (2S)-2-[[(2S)-2-[[1-(aminomethyl)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-3-carbonyl]amino]-4-methylpentanoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 101084738 |
| Molecular Formula | C22H31N5O4 |
| Molecular Weight | 429.52 g/mol |
| Exact Mass | 429.24 |
| IUPAC Name | (2S)-2-[[(2S)-2-[[1-(aminomethyl)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-3-carbonyl]amino]-4-methylpentanoyl]amino]propanoic acid |
| SMILES | CC(C)C[C@H](NC(=O)C1Cc2c([nH]c3ccccc23)C(CN)N1)C(=O)N[C@@H](C)C(=O)O |
| InChI | InChI=1S/C22H31N5O4/c1-11(2)8-16(20(28)24-12(3)22(30)31)27-21(29)17-9-14-13-6-4-5-7-15(13)26-19(14)18(10-23)25-17/h4-7,11-12,16-18,25-26H,8-10,23H2,1-3H3,(H,24,28)(H,27,29)(H,30,31)/t12-,16-,17?,18?/m0/s1 |
| InChIKey | STKDVOJKTUHDKJ-VJZABPCPSA-N |
| XLogP | 0.80 |
| TPSA | 149.34 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.52 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|