C31H34N4O4 — CID 10098389
methyl 6-amino-2-[[1-(4-phenoxyphenyl)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-3-carbonyl]amino]hexanoate (PubChem CID 10098389) has the molecular formula C31H34N4O4 and a molecular weight of 526.64 g/mol. Its IUPAC name is methyl 6-amino-2-[[1-(4-phenoxyphenyl)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-3-carbonyl]amino]hexanoate.
| Compound Name | methyl 6-amino-2-[[1-(4-phenoxyphenyl)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-3-carbonyl]amino]hexanoate |
|---|---|
| PubChem CID | 10098389 |
| Molecular Formula | C31H34N4O4 |
| Molecular Weight | 526.64 g/mol |
| Exact Mass | 526.26 |
| IUPAC Name | methyl 6-amino-2-[[1-(4-phenoxyphenyl)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-3-carbonyl]amino]hexanoate |
| SMILES | COC(=O)C(CCCCN)NC(=O)C1Cc2c([nH]c3ccccc23)C(c2ccc(Oc3ccccc3)cc2)N1 |
| InChI | InChI=1S/C31H34N4O4/c1-38-31(37)26(13-7-8-18-32)35-30(36)27-19-24-23-11-5-6-12-25(23)33-29(24)28(34-27)20-14-16-22(17-15-20)39-21-9-3-2-4-10-21/h2-6,9-12,14-17,26-28,33-34H,7-8,13,18-19,32H2,1H3,(H,35,36) |
| InChIKey | APEXQDNKWWYIIY-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 118.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.64 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|