C27H24N4O5 — CID 141429938
(2S)-2-[[(1R,3S)-1-(4-nitrophenyl)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-3-carbonyl]amino]-3-phenylpropanoic acid (PubChem CID 141429938) has the molecular formula C27H24N4O5 and a molecular weight of 484.51 g/mol. Its IUPAC name is (2S)-2-[[(1R,3S)-1-(4-nitrophenyl)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-3-carbonyl]amino]-3-phenylpropanoic acid.
| Compound Name | (2S)-2-[[(1R,3S)-1-(4-nitrophenyl)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-3-carbonyl]amino]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 141429938 |
| Molecular Formula | C27H24N4O5 |
| Molecular Weight | 484.51 g/mol |
| Exact Mass | 484.17 |
| IUPAC Name | (2S)-2-[[(1R,3S)-1-(4-nitrophenyl)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-3-carbonyl]amino]-3-phenylpropanoic acid |
| SMILES | O=C(O)[C@H](Cc1ccccc1)NC(=O)[C@@H]1Cc2c([nH]c3ccccc23)[C@@H](c2ccc([N+](=O)[O-])cc2)N1 |
| InChI | InChI=1S/C27H24N4O5/c32-26(30-23(27(33)34)14-16-6-2-1-3-7-16)22-15-20-19-8-4-5-9-21(19)28-25(20)24(29-22)17-10-12-18(13-11-17)31(35)36/h1-13,22-24,28-29H,14-15H2,(H,30,32)(H,33,34)/t22-,23-,24+/m0/s1 |
| InChIKey | UKHPQSNHHQGZLT-KMDXXIMOSA-N |
| XLogP | 3.49 |
| TPSA | 137.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.51 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|