C28H28N4O7 — CID 10392281
(2R)-2-[[(2R)-3-(4-hydroxyphenyl)-2-[[(3R)-1,2,3,4-tetrahydroisoquinoline-3-carbonyl]amino]propanoyl]amino]-3-(4-nitrophenyl)propanoic acid (PubChem CID 10392281) has the molecular formula C28H28N4O7 and a molecular weight of 532.55 g/mol. Its IUPAC name is (2R)-2-[[(2R)-3-(4-hydroxyphenyl)-2-[[(3R)-1,2,3,4-tetrahydroisoquinoline-3-carbonyl]amino]propanoyl]amino]-3-(4-nitrophenyl)propanoic acid.
| Compound Name | (2R)-2-[[(2R)-3-(4-hydroxyphenyl)-2-[[(3R)-1,2,3,4-tetrahydroisoquinoline-3-carbonyl]amino]propanoyl]amino]-3-(4-nitrophenyl)propanoic acid |
|---|---|
| PubChem CID | 10392281 |
| Molecular Formula | C28H28N4O7 |
| Molecular Weight | 532.55 g/mol |
| Exact Mass | 532.20 |
| IUPAC Name | (2R)-2-[[(2R)-3-(4-hydroxyphenyl)-2-[[(3R)-1,2,3,4-tetrahydroisoquinoline-3-carbonyl]amino]propanoyl]amino]-3-(4-nitrophenyl)propanoic acid |
| SMILES | O=C(O)[C@@H](Cc1ccc([N+](=O)[O-])cc1)NC(=O)[C@@H](Cc1ccc(O)cc1)NC(=O)[C@H]1Cc2ccccc2CN1 |
| InChI | InChI=1S/C28H28N4O7/c33-22-11-7-18(8-12-22)13-24(30-26(34)23-15-19-3-1-2-4-20(19)16-29-23)27(35)31-25(28(36)37)14-17-5-9-21(10-6-17)32(38)39/h1-12,23-25,29,33H,13-16H2,(H,30,34)(H,31,35)(H,36,37)/t23-,24-,25-/m1/s1 |
| InChIKey | HCWPBJKYAZWKGG-UBFVSLLYSA-N |
| XLogP | 1.85 |
| TPSA | 170.90 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.55 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|