C32H40CuN6O8S4 — CID 53389621
copper bis(3-sulfanyl-2-[[3-sulfanyl-2-[[(3S)-1,2,3,4-tetrahydroisoquinoline-3-carbonyl]amino]propanoyl]amino]propanoate) (PubChem CID 53389621) has the molecular formula C32H40CuN6O8S4 and a molecular weight of 828.52 g/mol. Its IUPAC name is copper bis(3-sulfanyl-2-[[3-sulfanyl-2-[[(3S)-1,2,3,4-tetrahydroisoquinoline-3-carbonyl]amino]propanoyl]amino]propanoate).
| Compound Name | copper bis(3-sulfanyl-2-[[3-sulfanyl-2-[[(3S)-1,2,3,4-tetrahydroisoquinoline-3-carbonyl]amino]propanoyl]amino]propanoate) |
|---|---|
| PubChem CID | 53389621 |
| Molecular Formula | C32H40CuN6O8S4 |
| Molecular Weight | 828.52 g/mol |
| Exact Mass | 827.11 |
| IUPAC Name | copper bis(3-sulfanyl-2-[[3-sulfanyl-2-[[(3S)-1,2,3,4-tetrahydroisoquinoline-3-carbonyl]amino]propanoyl]amino]propanoate) |
| SMILES | O=C([O-])C(CS)NC(=O)C(CS)NC(=O)[C@@H]1Cc2ccccc2CN1.O=C([O-])C(CS)NC(=O)C(CS)NC(=O)[C@@H]1Cc2ccccc2CN1.[Cu+2] |
| InChI | InChI=1S/2C16H21N3O4S2.Cu/c2*20-14(11-5-9-3-1-2-4-10(9)6-17-11)18-12(7-24)15(21)19-13(8-25)16(22)23;/h2*1-4,11-13,17,24-25H,5-8H2,(H,18,20)(H,19,21)(H,22,23);/q;;+2/p-2/t2*11-,12?,13?;/m00./s1 |
| InChIKey | AAEDCDJPXSSVOG-UHCNUQMYSA-L |
| XLogP | -3.44 |
| TPSA | 220.72 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 51 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 828.52 |
| LogP ≤ 5 | -3.44 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|