C23H24N4O5S — CID 141429942
(2S)-4-methylsulfanyl-2-[[(1R,3S)-1-(4-nitrophenyl)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-3-carbonyl]amino]butanoic acid (PubChem CID 141429942) has the molecular formula C23H24N4O5S and a molecular weight of 468.54 g/mol. Its IUPAC name is (2S)-4-methylsulfanyl-2-[[(1R,3S)-1-(4-nitrophenyl)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-3-carbonyl]amino]butanoic acid.
| Compound Name | (2S)-4-methylsulfanyl-2-[[(1R,3S)-1-(4-nitrophenyl)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-3-carbonyl]amino]butanoic acid |
|---|---|
| PubChem CID | 141429942 |
| Molecular Formula | C23H24N4O5S |
| Molecular Weight | 468.54 g/mol |
| Exact Mass | 468.15 |
| IUPAC Name | (2S)-4-methylsulfanyl-2-[[(1R,3S)-1-(4-nitrophenyl)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-3-carbonyl]amino]butanoic acid |
| SMILES | CSCC[C@H](NC(=O)[C@@H]1Cc2c([nH]c3ccccc23)[C@@H](c2ccc([N+](=O)[O-])cc2)N1)C(=O)O |
| InChI | InChI=1S/C23H24N4O5S/c1-33-11-10-18(23(29)30)26-22(28)19-12-16-15-4-2-3-5-17(15)24-21(16)20(25-19)13-6-8-14(9-7-13)27(31)32/h2-9,18-20,24-25H,10-12H2,1H3,(H,26,28)(H,29,30)/t18-,19-,20+/m0/s1 |
| InChIKey | QYVCMULBNYOJLP-SLFFLAALSA-N |
| XLogP | 3.00 |
| TPSA | 137.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.54 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|