C32H33F3N4O4 — CID 11758199
methyl 6-amino-2-[[1-[4-[4-(trifluoromethyl)phenoxy]phenyl]-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-3-carbonyl]amino]hexanoate (PubChem CID 11758199) has the molecular formula C32H33F3N4O4 and a molecular weight of 594.63 g/mol. Its IUPAC name is methyl 6-amino-2-[[1-[4-[4-(trifluoromethyl)phenoxy]phenyl]-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-3-carbonyl]amino]hexanoate.
| Compound Name | methyl 6-amino-2-[[1-[4-[4-(trifluoromethyl)phenoxy]phenyl]-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-3-carbonyl]amino]hexanoate |
|---|---|
| PubChem CID | 11758199 |
| Molecular Formula | C32H33F3N4O4 |
| Molecular Weight | 594.63 g/mol |
| Exact Mass | 594.25 |
| IUPAC Name | methyl 6-amino-2-[[1-[4-[4-(trifluoromethyl)phenoxy]phenyl]-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-3-carbonyl]amino]hexanoate |
| SMILES | COC(=O)C(CCCCN)NC(=O)C1Cc2c([nH]c3ccccc23)C(c2ccc(Oc3ccc(C(F)(F)F)cc3)cc2)N1 |
| InChI | InChI=1S/C32H33F3N4O4/c1-42-31(41)26(8-4-5-17-36)39-30(40)27-18-24-23-6-2-3-7-25(23)37-29(24)28(38-27)19-9-13-21(14-10-19)43-22-15-11-20(12-16-22)32(33,34)35/h2-3,6-7,9-16,26-28,37-38H,4-5,8,17-18,36H2,1H3,(H,39,40) |
| InChIKey | PCVQPLNJEWSKIF-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 118.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.63 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|