C23H21FN2O5 — CID 66641155
1-O-ethyl 3-O-methyl 2-(4-fluorobenzoyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-1,3-dicarboxylate (PubChem CID 66641155) has the molecular formula C23H21FN2O5 and a molecular weight of 424.43 g/mol. Its IUPAC name is 1-O-ethyl 3-O-methyl 2-(4-fluorobenzoyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-1,3-dicarboxylate.
| Compound Name | 1-O-ethyl 3-O-methyl 2-(4-fluorobenzoyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-1,3-dicarboxylate |
|---|---|
| PubChem CID | 66641155 |
| Molecular Formula | C23H21FN2O5 |
| Molecular Weight | 424.43 g/mol |
| Exact Mass | 424.14 |
| IUPAC Name | 1-O-ethyl 3-O-methyl 2-(4-fluorobenzoyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-1,3-dicarboxylate |
| SMILES | CCOC(=O)C1c2[nH]c3ccccc3c2CC(C(=O)OC)N1C(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C23H21FN2O5/c1-3-31-23(29)20-19-16(15-6-4-5-7-17(15)25-19)12-18(22(28)30-2)26(20)21(27)13-8-10-14(24)11-9-13/h4-11,18,20,25H,3,12H2,1-2H3 |
| InChIKey | SEMPWEIZJXMBMW-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 88.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.43 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|