C14H15N2O3- — CID 141093610
methyl 1-methyl-2-oxido-1,3,4,9-tetrahydropyrido[3,4-b]indole-3-carboxylate (PubChem CID 141093610) has the molecular formula C14H15N2O3- and a molecular weight of 259.28 g/mol. Its IUPAC name is methyl 1-methyl-2-oxido-1,3,4,9-tetrahydropyrido[3,4-b]indole-3-carboxylate.
| Compound Name | methyl 1-methyl-2-oxido-1,3,4,9-tetrahydropyrido[3,4-b]indole-3-carboxylate |
|---|---|
| PubChem CID | 141093610 |
| Molecular Formula | C14H15N2O3- |
| Molecular Weight | 259.28 g/mol |
| Exact Mass | 259.11 |
| IUPAC Name | methyl 1-methyl-2-oxido-1,3,4,9-tetrahydropyrido[3,4-b]indole-3-carboxylate |
| SMILES | COC(=O)C1Cc2c([nH]c3ccccc23)C(C)N1[O-] |
| InChI | InChI=1S/C14H15N2O3/c1-8-13-10(7-12(16(8)18)14(17)19-2)9-5-3-4-6-11(9)15-13/h3-6,8,12,15H,7H2,1-2H3/q-1 |
| InChIKey | ARYKLGRIOVWAMP-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 68.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.28 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|