C15H15N2O3- — CID 6968378
(1S,3S)-2-acetyl-1-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indole-3-carboxylate (PubChem CID 6968378) has the molecular formula C15H15N2O3- and a molecular weight of 271.30 g/mol. Its IUPAC name is (1S,3S)-2-acetyl-1-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indole-3-carboxylate.
| Compound Name | (1S,3S)-2-acetyl-1-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indole-3-carboxylate |
|---|---|
| PubChem CID | 6968378 |
| Molecular Formula | C15H15N2O3- |
| Molecular Weight | 271.30 g/mol |
| Exact Mass | 271.11 |
| IUPAC Name | (1S,3S)-2-acetyl-1-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indole-3-carboxylate |
| SMILES | CC(=O)N1[C@H](C(=O)[O-])Cc2c([nH]c3ccccc23)[C@@H]1C |
| InChI | InChI=1S/C15H16N2O3/c1-8-14-11(10-5-3-4-6-12(10)16-14)7-13(15(19)20)17(8)9(2)18/h3-6,8,13,16H,7H2,1-2H3,(H,19,20)/p-1/t8-,13-/m0/s1 |
| InChIKey | OSXCHCJGSVTSSB-SDBXPKJASA-M |
| XLogP | 0.75 |
| TPSA | 76.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.30 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|