C29H30N2O2 — CID 102063245
propan-2-yl (1R,3S)-2-benzhydryl-1-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indole-3-carboxylate (PubChem CID 102063245) has the molecular formula C29H30N2O2 and a molecular weight of 438.57 g/mol. Its IUPAC name is propan-2-yl (1R,3S)-2-benzhydryl-1-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indole-3-carboxylate.
| Compound Name | propan-2-yl (1R,3S)-2-benzhydryl-1-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indole-3-carboxylate |
|---|---|
| PubChem CID | 102063245 |
| Molecular Formula | C29H30N2O2 |
| Molecular Weight | 438.57 g/mol |
| Exact Mass | 438.23 |
| IUPAC Name | propan-2-yl (1R,3S)-2-benzhydryl-1-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indole-3-carboxylate |
| SMILES | CC(C)OC(=O)[C@@H]1Cc2c([nH]c3ccccc23)[C@@H](C)N1C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C29H30N2O2/c1-19(2)33-29(32)26-18-24-23-16-10-11-17-25(23)30-27(24)20(3)31(26)28(21-12-6-4-7-13-21)22-14-8-5-9-15-22/h4-17,19-20,26,28,30H,18H2,1-3H3/t20-,26+/m1/s1 |
| InChIKey | FGPWXOLGHOSZCP-IBVKSMDESA-N |
| XLogP | 6.20 |
| TPSA | 45.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.57 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|