C34H38N2O2 — CID 10994773
propan-2-yl (1R,3S)-2-benzhydryl-1-cyclohexyl-1,3,4,9-tetrahydropyrido[3,4-b]indole-3-carboxylate (PubChem CID 10994773) has the molecular formula C34H38N2O2 and a molecular weight of 506.69 g/mol. Its IUPAC name is propan-2-yl (1R,3S)-2-benzhydryl-1-cyclohexyl-1,3,4,9-tetrahydropyrido[3,4-b]indole-3-carboxylate.
| Compound Name | propan-2-yl (1R,3S)-2-benzhydryl-1-cyclohexyl-1,3,4,9-tetrahydropyrido[3,4-b]indole-3-carboxylate |
|---|---|
| PubChem CID | 10994773 |
| Molecular Formula | C34H38N2O2 |
| Molecular Weight | 506.69 g/mol |
| Exact Mass | 506.29 |
| IUPAC Name | propan-2-yl (1R,3S)-2-benzhydryl-1-cyclohexyl-1,3,4,9-tetrahydropyrido[3,4-b]indole-3-carboxylate |
| SMILES | CC(C)OC(=O)[C@@H]1Cc2c([nH]c3ccccc23)[C@@H](C2CCCCC2)N1C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C34H38N2O2/c1-23(2)38-34(37)30-22-28-27-20-12-13-21-29(27)35-31(28)33(26-18-10-5-11-19-26)36(30)32(24-14-6-3-7-15-24)25-16-8-4-9-17-25/h3-4,6-9,12-17,20-21,23,26,30,32-33,35H,5,10-11,18-19,22H2,1-2H3/t30-,33+/m0/s1 |
| InChIKey | FROHHXCUZNWRHL-BZKUTMRRSA-N |
| XLogP | 7.76 |
| TPSA | 45.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.69 |
| LogP ≤ 5 | 7.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|