C30H34N4O3S — CID 10186774
tert-butyl (1S,3R)-3-(1,3-benzothiazol-2-ylcarbamoyl)-1-cyclohexyl-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxylate (PubChem CID 10186774) has the molecular formula C30H34N4O3S and a molecular weight of 530.69 g/mol. Its IUPAC name is tert-butyl (1S,3R)-3-(1,3-benzothiazol-2-ylcarbamoyl)-1-cyclohexyl-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxylate.
| Compound Name | tert-butyl (1S,3R)-3-(1,3-benzothiazol-2-ylcarbamoyl)-1-cyclohexyl-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxylate |
|---|---|
| PubChem CID | 10186774 |
| Molecular Formula | C30H34N4O3S |
| Molecular Weight | 530.69 g/mol |
| Exact Mass | 530.24 |
| IUPAC Name | tert-butyl (1S,3R)-3-(1,3-benzothiazol-2-ylcarbamoyl)-1-cyclohexyl-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1[C@@H](C(=O)Nc2nc3ccccc3s2)Cc2c([nH]c3ccccc23)[C@@H]1C1CCCCC1 |
| InChI | InChI=1S/C30H34N4O3S/c1-30(2,3)37-29(36)34-23(27(35)33-28-32-22-15-9-10-16-24(22)38-28)17-20-19-13-7-8-14-21(19)31-25(20)26(34)18-11-5-4-6-12-18/h7-10,13-16,18,23,26,31H,4-6,11-12,17H2,1-3H3,(H,32,33,35)/t23-,26+/m1/s1 |
| InChIKey | VNKUMUIIDDUERU-BVAGGSTKSA-N |
| XLogP | 7.20 |
| TPSA | 87.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.69 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|