C18H13N3O2S — CID 6460295
N-(1,3-benzothiazol-2-yl)-2-(2-methyl-1H-indol-3-yl)-2-oxoacetamide (PubChem CID 6460295) has the molecular formula C18H13N3O2S and a molecular weight of 335.39 g/mol. Its IUPAC name is N-(1,3-benzothiazol-2-yl)-2-(2-methyl-1H-indol-3-yl)-2-oxoacetamide.
| Compound Name | N-(1,3-benzothiazol-2-yl)-2-(2-methyl-1H-indol-3-yl)-2-oxoacetamide |
|---|---|
| PubChem CID | 6460295 |
| Molecular Formula | C18H13N3O2S |
| Molecular Weight | 335.39 g/mol |
| Exact Mass | 335.07 |
| IUPAC Name | N-(1,3-benzothiazol-2-yl)-2-(2-methyl-1H-indol-3-yl)-2-oxoacetamide |
| SMILES | Cc1[nH]c2ccccc2c1C(=O)C(=O)Nc1nc2ccccc2s1 |
| InChI | InChI=1S/C18H13N3O2S/c1-10-15(11-6-2-3-7-12(11)19-10)16(22)17(23)21-18-20-13-8-4-5-9-14(13)24-18/h2-9,19H,1H3,(H,20,21,23) |
| InChIKey | JZUFURLKLYHTIP-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.39 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|