C15H11N3S — CID 155348789
N-(1H-indol-3-yl)-1,3-benzothiazol-2-amine (PubChem CID 155348789) has the molecular formula C15H11N3S and a molecular weight of 265.34 g/mol. Its IUPAC name is N-(1H-indol-3-yl)-1,3-benzothiazol-2-amine.
| Compound Name | N-(1H-indol-3-yl)-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 155348789 |
| Molecular Formula | C15H11N3S |
| Molecular Weight | 265.34 g/mol |
| Exact Mass | 265.07 |
| IUPAC Name | N-(1H-indol-3-yl)-1,3-benzothiazol-2-amine |
| SMILES | c1ccc2sc(Nc3c[nH]c4ccccc34)nc2c1 |
| InChI | InChI=1S/C15H11N3S/c1-2-6-11-10(5-1)13(9-16-11)18-15-17-12-7-3-4-8-14(12)19-15/h1-9,16H,(H,17,18) |
| InChIKey | ZHIXCCHJCABUIH-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.34 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |