C10H6BrN3S2 — CID 175655892
N-(4-bromo-1,3-thiazol-2-yl)-1,3-benzothiazol-2-amine (PubChem CID 175655892) has the molecular formula C10H6BrN3S2 and a molecular weight of 312.22 g/mol. Its IUPAC name is N-(4-bromo-1,3-thiazol-2-yl)-1,3-benzothiazol-2-amine.
| Compound Name | N-(4-bromo-1,3-thiazol-2-yl)-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 175655892 |
| Molecular Formula | C10H6BrN3S2 |
| Molecular Weight | 312.22 g/mol |
| Exact Mass | 310.92 |
| IUPAC Name | N-(4-bromo-1,3-thiazol-2-yl)-1,3-benzothiazol-2-amine |
| SMILES | Brc1csc(Nc2nc3ccccc3s2)n1 |
| InChI | InChI=1S/C10H6BrN3S2/c11-8-5-15-9(13-8)14-10-12-6-3-1-2-4-7(6)16-10/h1-5H,(H,12,13,14) |
| InChIKey | HJPWDKSZUKONKJ-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.22 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |