C24H18N6O2S4 — CID 59707819
ethyl 2,2-bis[2-(1,3-benzothiazol-2-ylamino)-1,3-thiazol-4-yl]acetate (PubChem CID 59707819) has the molecular formula C24H18N6O2S4 and a molecular weight of 550.72 g/mol. Its IUPAC name is ethyl 2,2-bis[2-(1,3-benzothiazol-2-ylamino)-1,3-thiazol-4-yl]acetate.
| Compound Name | ethyl 2,2-bis[2-(1,3-benzothiazol-2-ylamino)-1,3-thiazol-4-yl]acetate |
|---|---|
| PubChem CID | 59707819 |
| Molecular Formula | C24H18N6O2S4 |
| Molecular Weight | 550.72 g/mol |
| Exact Mass | 550.04 |
| IUPAC Name | ethyl 2,2-bis[2-(1,3-benzothiazol-2-ylamino)-1,3-thiazol-4-yl]acetate |
| SMILES | CCOC(=O)C(c1csc(Nc2nc3ccccc3s2)n1)c1csc(Nc2nc3ccccc3s2)n1 |
| InChI | InChI=1S/C24H18N6O2S4/c1-2-32-20(31)19(15-11-33-21(27-15)29-23-25-13-7-3-5-9-17(13)35-23)16-12-34-22(28-16)30-24-26-14-8-4-6-10-18(14)36-24/h3-12,19H,2H2,1H3,(H,25,27,29)(H,26,28,30) |
| InChIKey | LXSMSJKACILNSH-UHFFFAOYSA-N |
| XLogP | 7.00 |
| TPSA | 101.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.72 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |