C14H7BrFN3S — CID 107533140
4-(1,3-benzothiazol-2-ylamino)-2-bromo-3-fluorobenzonitrile (PubChem CID 107533140) has the molecular formula C14H7BrFN3S and a molecular weight of 348.20 g/mol. Its IUPAC name is 4-(1,3-benzothiazol-2-ylamino)-2-bromo-3-fluorobenzonitrile.
| Compound Name | 4-(1,3-benzothiazol-2-ylamino)-2-bromo-3-fluorobenzonitrile |
|---|---|
| PubChem CID | 107533140 |
| Molecular Formula | C14H7BrFN3S |
| Molecular Weight | 348.20 g/mol |
| Exact Mass | 346.95 |
| IUPAC Name | 4-(1,3-benzothiazol-2-ylamino)-2-bromo-3-fluorobenzonitrile |
| SMILES | N#Cc1ccc(Nc2nc3ccccc3s2)c(F)c1Br |
| InChI | InChI=1S/C14H7BrFN3S/c15-12-8(7-17)5-6-10(13(12)16)19-14-18-9-3-1-2-4-11(9)20-14/h1-6H,(H,18,19) |
| InChIKey | SLCXWHNNPCUCCJ-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 48.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.20 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |