C38H42N2O6 — CID 87887486
(1R,3R)-1-cyclohexyl-3-methyl-2-[(2-methylpropan-2-yl)oxycarbonyl]-4,9-dihydro-1H-pyrido[3,4-b]indole-3-carboxylic acid;4-(4-formylphenyl)benzaldehyde (PubChem CID 87887486) has the molecular formula C38H42N2O6 and a molecular weight of 622.76 g/mol. Its IUPAC name is (1R,3R)-1-cyclohexyl-3-methyl-2-[(2-methylpropan-2-yl)oxycarbonyl]-4,9-dihydro-1H-pyrido[3,4-b]indole-3-carboxylic acid;4-(4-formylphenyl)benzaldehyde.
| Compound Name | (1R,3R)-1-cyclohexyl-3-methyl-2-[(2-methylpropan-2-yl)oxycarbonyl]-4,9-dihydro-1H-pyrido[3,4-b]indole-3-carboxylic acid;4-(4-formylphenyl)benzaldehyde |
|---|---|
| PubChem CID | 87887486 |
| Molecular Formula | C38H42N2O6 |
| Molecular Weight | 622.76 g/mol |
| Exact Mass | 622.30 |
| IUPAC Name | (1R,3R)-1-cyclohexyl-3-methyl-2-[(2-methylpropan-2-yl)oxycarbonyl]-4,9-dihydro-1H-pyrido[3,4-b]indole-3-carboxylic acid;4-(4-formylphenyl)benzaldehyde |
| SMILES | CC(C)(C)OC(=O)N1[C@H](C2CCCCC2)c2[nH]c3ccccc3c2C[C@]1(C)C(=O)O.O=Cc1ccc(-c2ccc(C=O)cc2)cc1 |
| InChI | InChI=1S/C24H32N2O4.C14H10O2/c1-23(2,3)30-22(29)26-20(15-10-6-5-7-11-15)19-17(14-24(26,4)21(27)28)16-12-8-9-13-18(16)25-19;15-9-11-1-5-13(6-2-11)14-7-3-12(10-16)4-8-14/h8-9,12-13,15,20,25H,5-7,10-11,14H2,1-4H3,(H,27,28);1-10H/t20-,24-;/m1./s1 |
| InChIKey | DPUFDFOCOPIDBG-OSMGBBKRSA-N |
| XLogP | 8.40 |
| TPSA | 116.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.76 |
| LogP ≤ 5 | 8.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|